On Target ESR1_HUMAN 0.45/CHEMBL378581
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.45, the most similar ligand is CHEMBL378581. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL378581 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | Oc1ccc2c(CCN(c3ccccc3Cl)S2(=O)=O)c1 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0000c052 62804008 21100102 01b10600 20080000 80000000 02010020 08040000 00000000 00480840 0c202004 60088800 0a140407 08000001 803a0040 00020048 00042080 0a000000 08400820 00026600 c0100000 18200900 200c0040 99410019 02002080 90000404 00000000 0000008c 04008400 20060002 00000000 00030660 |