On Target ESR1_HUMAN 0.35416666/CHEMBL3925390
For the given ligand Dolutegravir, we have found in our database that, being scored 0.35416666, the most similar ligand is CHEMBL3925390. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3925390 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | COc1ccc(CN(Cc2ccc(cc2)C(=O)N3CCc4ccc(O)cc4C3)Cc5ccccn5)cc1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0000000a 44801808 20104108 50010e00 00041020 00100000 02040000 02003005 00000180 00080840 08210004 40008000 80008882 00200000 01020481 0204010c 00002200 02000022 00200000 00020200 c0020000 18228600 20804000 8144001c 00100000 c0000000 00324040 80000000 04000304 00060003 a0040000 00004600 |