On Target 5HT2C_HUMAN 0.42635658/CHEMBL1222293
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.42635658, the most similar ligand is CHEMBL1222293. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL1222293 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CC(C)N(c1cccc(c1)N2CCN(C)CC2)S(=O)(=O)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000c012 00800200 01000222 05b00600 00080000 10000000 00000800 00000000 00000000 00000a40 00202004 60008800 02040406 00002001 80280040 00020000 00042000 00000400 08400000 00006000 c0100000 28000900 20040060 0a40001a 02082080 00100004 10000400 0000008c 08808404 20060000 00000000 00030260 |