On Target PTGES_HUMAN 0.36936936/CHEMBL1080552
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.36936936, the most similar ligand is CHEMBL1080552. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL1080552 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | OC1C(NS(=O)(=O)c2ccccc12)C(=O)Nc3ccc(cc3)c4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0000e0d2 20800a00 01100120 01b10600 20088000 00006008 04030000 00040000 00040900 00480ac0 08382004 6029b800 3e008005 0c108001 80320040 000c8008 00062080 02000001 0ce00038 00006401 c0140100 3c020721 3b182080 f9400078 02002800 80100004 00040000 100000cc 0c00d400 2006000b 40000002 01130660 |