On Target MIF_HUMAN 0.23870967/CHEMBL3409229
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.23870967, the most similar ligand is CHEMBL3409229. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3409229 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | NS(=O)(=O)c1ccc(CN=C=S)cc1 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000010 00801000 01000100 00b10620 00000008 00000000 00000000 00001000 00000000 00000840 00002000 60008000 00000800 00080001 80200000 00000000 00200800 02000200 00000000 00002000 80000002 28088000 00000000 08400808 00200000 80100000 40000000 00000028 00000000 20060000 00040000 00010028 |