On Target 5HT2B_HUMAN 0.398773/CHEMBL493951
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.398773, the most similar ligand is CHEMBL493951. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL493951 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CN(CC1CC1)S(=O)(=O)c2ccc3CCNCCc3c2 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000010 00801000 01102100 01b10600 00080128 00010000 00000000 00000001 00800080 004808c0 08202000 6080c000 00000002 01200001 80600080 00000100 00002200 02100000 00400000 00006601 80000000 18240000 00004000 99400018 02000000 80000004 00000000 1000102c 04000400 20060002 00000000 00012671 |