On Target 5HT2B_HUMAN 0.384/CHEMBL472415
For the given ligand Dolutegravir, we have found in our database that, being scored 0.384, the most similar ligand is CHEMBL472415. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL472415 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | O=C(N1CCC(CC1)c2nc3ccccc3[nH]2)c4ccc(cn4)c5ccccc5 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0000200a 01001800 00104500 50010e10 04041060 04104008 00000020 22003001 00000100 000008d0 01298004 50818000 80008802 08500000 00020440 820c0104 00020000 06000006 04200008 10000203 60000000 18078620 31802000 0050001c 00140001 c0080000 08000240 90000140 00404104 00c60801 e0040020 20004280 |