On Target MK03_HUMAN 0.31640625/CHEMBL1336
For the given ligand Dolutegravir, we have found in our database that, being scored 0.31640625, the most similar ligand is CHEMBL1336. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL1336 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(c3)C(F)(F)F)cc2)ccn1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 00008006 44000808 20104108 10010e40 04041020 00100000 02000400 02003009 00000000 00000850 00290004 40008804 02008826 09100000 01024041 2204010c 00040000 02000004 08282000 00060010 40402100 08028700 20822000 00448004 00142000 80000200 000c0040 90200080 00408384 00060001 80140400 02264200 |