On Target TRPV1_RAT 0.3448276/CHEMBL1940379
For the given ligand Gliclazide, we have found in our database that, being scored 0.3448276, the most similar ligand is CHEMBL1940379. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL1940379 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | CC(C(=O)NCC1CC1(c2ccccc2)c3ccccc3)c4ccc(NS(=O)(=O)C)c(F)c4 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00000002 01001a00 00100102 42310600 00000000 00400010 00000000 21000000 00100980 000828c0 08302004 50019000 01008402 01201001 c0080040 00060000 00000400 12000000 00000000 00004201 40000100 18240e00 20000000 81500018 00000084 a0000000 80000000 5000000d 04200080 0006800b 00002000 00012660 |