On Target SC6A4_HUMAN 0.41538462/CHEMBL2021577
For the given ligand Saxagliptin, we have found in our database that, being scored 0.41538462, the most similar ligand is CHEMBL2021577. Check out the elaboration below.
| Saxagliptin (Given Ligand) | CHEMBL2021577 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | CCOC[C@H]1[C@@H]2CNC[C@]12C |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00000000 01000000 00100000 00010500 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50018000 00000002 01000000 00000000 00081008 00800000 00000000 00400000 00000201 00000020 10000000 01000000 00100010 00000400 00000000 00000200 10000000 00000200 00040000 00000000 00002a00 |