On Target SC6A4_HUMAN 0.42982456/CHEMBL512665
For the given ligand Gliclazide, we have found in our database that, being scored 0.42982456, the most similar ligand is CHEMBL512665. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL512665 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | CCCCN(C1CCNCC1)S(=O)(=O)c2ccc3ccccc3c2 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00000010 01800400 01100000 01b00600 00080000 00000000 00000000 20000000 00000000 004009e0 00202000 70018000 00000002 00000001 80e00000 00000000 00002000 00000000 00400000 00007603 80000000 18000008 00000000 18400018 02000000 0000000c 00000000 1000000c 00000400 20060010 00000000 00012270 |