On Target HYES_HUMAN 0.5691057/CHEMBL512310
For the given ligand Gliclazide, we have found in our database that, being scored 0.5691057, the most similar ligand is CHEMBL512310. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL512310 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | Cc1cc(C)c(c(C)c1)S(=O)(=O)N2CCC(CC2)C(=O)NN3CCCCC3 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00020014 03801000 01100100 01b10600 00080009 00000008 00000000 20000000 02200000 004008c0 00302008 70039000 04008002 00200001 a0700180 00000008 00002080 02000000 04400000 00006601 80000000 18000600 40004000 18400018 02002000 80000004 00000000 1000002c 01000400 200e0202 00000000 00850278 |