On Target PPARG_HUMAN 0.5405405/CHEMBL1836976
For the given ligand Saxagliptin, we have found in our database that, being scored 0.5405405, the most similar ligand is CHEMBL1836976. Check out the elaboration below.
| Saxagliptin (Given Ligand) | CHEMBL1836976 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | C[C@]12CC[C@@](C)(C[C@H]1C3=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC2)C(=O)NCCN |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00010000 01002000 00100000 00000400 00080000 00000000 00000080 20000402 01000000 00108080 00200000 40011000 0402800a 00800000 00000400 00080008 00000000 00000020 02412000 00000201 00000000 30000690 01008001 02100018 00200000 00000000 00404000 90000000 08000000 00040001 24020000 00000200 |