On Target CASP1_HUMAN 0.36585367/CHEMBL466565
For the given ligand Miglitol, we have found in our database that, being scored 0.36585367, the most similar ligand is CHEMBL466565. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL466565 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CC(C)C[C@H]1C[C@H]([C@@H](O)CC(=O)Cc2ccccc2)C(=O)N1 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00030000 01001000 00100102 00010600 00180000 00000010 00000000 20000000 00000800 000a08c0 08300000 40019000 1500801a 00a00000 40000000 00080008 00000000 02000000 00c02000 00000201 00000100 18040610 01000080 00500018 00000001 80000000 00000000 10000000 00000002 00060003 00022000 00002e00 |