On Target PDE4B_HUMAN 0.31932774/CHEMBL144499
For the given ligand Saxagliptin, we have found in our database that, being scored 0.31932774, the most similar ligand is CHEMBL144499. Check out the elaboration below.
| Saxagliptin (Given Ligand) | CHEMBL144499 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | COc1ccc(cc1OC2CCCC2)[C@H]3CCN4[C@@H]3CCC4=O |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 04030000 43001208 2010010a 00210700 00081000 c2000010 02040000 20000004 00000880 000808c0 08300000 40019000 0480c00a 20200080 11000001 020ca008 00800000 02000000 00482000 00020201 00000100 18240610 01000000 81500018 00000000 80000000 00120000 10000000 04000202 0106000b 00020000 00802640 |