On Target BACE1_HUMAN 0.32960895/CHEMBL1097325
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.32960895, the most similar ligand is CHEMBL1097325. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1097325 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CCCN(CCC)C(=O)c1cc(C)cc(c1)C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)[C@H]3CN(CCN3)S(=O)(=O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008098 03805e00 01100102 07b10600 00080081 10000010 10820000 22001004 00300880 00492de0 08302000 f0038800 02008806 00203001 81700400 08088008 10002000 02400000 00e02800 00006605 80000100 382e8710 030000e1 bb50003c 02002001 c0000004 98000000 9000000d 0c300502 20068013 a0040002 00032670 |