On Target ALDR_HUMAN 0.1724138/CHEMBL269550
For the given ligand Miglitol, we have found in our database that, being scored 0.1724138, the most similar ligand is CHEMBL269550. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL269550 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CCOC(=O)C1=C(O)C(=O)N(Cc2ccccc2)C1 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00000008 00809000 00100100 10010600 00000080 08000000 02100000 02001c00 01000000 00000840 40200000 4000d000 88008802 00090000 00080400 00080008 30220800 02000101 20a50010 00000200 80002020 38108f00 03000080 00400018 00001401 c8008800 00480200 80000400 00004300 00060001 2c040000 00000210 |