On Target ACM1_HUMAN 0.5135135/CHEMBL355193
For the given ligand Saxagliptin, we have found in our database that, being scored 0.5135135, the most similar ligand is CHEMBL355193. Check out the elaboration below.
| Saxagliptin (Given Ligand) | CHEMBL355193 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | CC1CN(CCC[C@@H]2[C@H]3CCCC[C@@H]3C[C@H]4[C@@H]2[C@H](C)OC4=O)C(C)CN1 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00050040 01000000 00100100 04010700 00080000 00000000 00000000 20000000 00000000 00000080 00200000 40019000 0400800a 00802000 00080000 00081008 00820000 00000000 02402000 00000201 00000020 30000a10 01000021 02100010 00000400 00000000 00000000 10000000 08000200 00040002 00020000 00002200 |