On Target ACM1_HUMAN 0.488/CHEMBL179993
For the given ligand Gliclazide, we have found in our database that, being scored 0.488, the most similar ligand is CHEMBL179993. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL179993 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | CCN(C1CCN(CCC(c2ccccc2)c3ccccc3)CC1)C(=O)Cc4ccc(cc4)S(=O)(=O)N(C)C |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00000010 01801600 01100100 00b10600 00000008 00000000 00000000 21000000 00000880 000809e0 08302000 70019000 01008002 00000001 c0200000 00040000 00002000 02000000 00400000 00006201 80000100 182c0600 00000000 89500018 00000000 a0000000 00000000 5000002c 04000480 2006001b 00002000 00012660 |