On Target PGH1_SHEEP 0.23584905/CHEMBL3809863
For the given ligand Miglitol, we have found in our database that, being scored 0.23584905, the most similar ligand is CHEMBL3809863. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL3809863 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 01010000 01407000 00100100 04010600 00000080 0001c000 00000000 20000008 00800300 000008c0 00200000 4001b000 0e008002 00012001 80180000 021a0008 10020000 02080400 00000890 00000201 00000000 38040e30 03000003 02500018 00000000 80002002 00000000 10200020 08000200 00060001 e0004000 00000200 |