On Target PGH1_SHEEP 0.30921054/CHEMBL9123
For the given ligand Gliclazide, we have found in our database that, being scored 0.30921054, the most similar ligand is CHEMBL9123. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL9123 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | O=C1CCN(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 0000000c 09801800 00100100 10010e00 00400000 00008000 00000104 02003002 02000000 c0000948 00300008 60009200 09009802 00700000 20000600 0000000c 00002000 02000001 84100030 00001003 c0020100 180b8680 40004000 0040001c 00202000 c1200000 00000000 80000000 01000100 00ce0013 80040000 00040380 |