On Target NMDE2_HUMAN 0.33613446/CHEMBL151489
For the given ligand Gliclazide, we have found in our database that, being scored 0.33613446, the most similar ligand is CHEMBL151489. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL151489 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | C(CN1CCC(Cc2ccccc2)CC1)Sc3ccccc3 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00000000 01800200 20120102 08110600 00000000 80000000 00000000 20000000 00100800 020a48c0 08700000 70018000 00000002 00240000 00000000 00000000 04000000 02000000 00000000 00020201 80000100 18000000 00800000 04500019 00000000 80000000 00004000 10000000 00000000 00060002 10000000 02010620 |