On Target GRM5_HUMAN 0.275/CHEMBL1451902
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.275, the most similar ligand is CHEMBL1451902. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1451902 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CS(=O)(=O)N(CC(=O)Nc1cccc(Cl)c1)c2ccccc2Cl |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000c082 00000000 00000022 01300600 00008000 00000000 08020020 08000000 00000000 00000a40 00282004 4000a800 02108404 00102201 80080040 00028040 00040000 10000000 08200000 00004400 40140000 28000f00 20002000 20010022 02002080 00000480 00000000 0000008c 08008000 00060001 00005000 00130260 |