On Target OPRM_MOUSE 0.39506173/CHEMBL2057689
For the given ligand Miglitol, we have found in our database that, being scored 0.39506173, the most similar ligand is CHEMBL2057689. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL2057689 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | O[C@@]12CCC(=O)C[C@@]13CCN(CC4CC4)[C@@H]2CC5=C3CCCC5 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00050000 89000000 00100800 00000400 00180080 00000000 00080000 20000402 10000000 00100088 00200200 51011000 0402801a 01800000 00080404 00080008 10004000 00000060 02402000 02002201 00000000 10000210 03008000 00100010 00200000 00000000 00404000 90000000 04000000 80040400 24020000 00002a00 |