On Target OPRM_MOUSE 0.34705883/CHEMBL186281
For the given ligand Gliclazide, we have found in our database that, being scored 0.34705883, the most similar ligand is CHEMBL186281. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL186281 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | CCNC(=O)c1ccc(cc1)C(=C2CC3CCC(C2)N3Cc4cocc4)c5ccc(cc5)S(=O)(=O)N |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00000010 09a01800 01180300 40b10600 00000009 00000010 80080080 23201410 00024100 001808c8 0c202000 70018800 c0028c02 00000001 80204402 20000000 00000400 02030040 40002000 00002201 81000000 18068616 00008020 0858001c 01000004 e0004000 00406010 d8801028 00400180 20060c03 a4060000 00012620 |