On Target SCN9A_HUMAN 0.34285715/CHEMBL206758
For the given ligand Saxagliptin, we have found in our database that, being scored 0.34285715, the most similar ligand is CHEMBL206758. Check out the elaboration below.
| Saxagliptin (Given Ligand) | CHEMBL206758 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | OC(CCc1ccccc1)[C@@H]2CCC[C@H]2C(=O)NCc3cc(Cl)cc(Cl)c3 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00058000 09800000 00100102 00010600 00180000 00000020 04000000 22001000 00000800 000808c8 08300000 40019800 0600880e 00a00400 80000400 00080008 00000000 02000000 00402000 00000201 80000100 18008710 01000040 00500018 00002000 c0000000 00000000 90000000 00000102 01060003 20060000 00020e00 |