On Target AA2AR_HUMAN 0.33684212/CHEMBL486282
For the given ligand Gliclazide, we have found in our database that, being scored 0.33684212, the most similar ligand is CHEMBL486282. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL486282 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | CCCN1C(=O)Nc2nc([nH]c2C1=O)c3ccc(cc3)S(=O)(=O)NC4CCN(Cc5ccccc5)CC4 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 0000803a 01801c00 01180100 13b10600 00080068 0000c000 00009000 22081408 16400100 904019e0 0c20a00c 70018800 02009802 00d01001 80aa0480 080c000c 00002000 0200a000 00400000 00407603 80000100 38008050 21802041 1870001c 02040000 c020000c 60000000 9004002c 00004504 20460c10 e00c0800 400102e0 |