On Target ACE_HUMAN 0.65753424/CHEMBL430630
For the given ligand Saxagliptin, we have found in our database that, being scored 0.65753424, the most similar ligand is CHEMBL430630. Check out the elaboration below.
| Saxagliptin (Given Ligand) | CHEMBL430630 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | NCCCCC(N)C(=O)N[C@H](CCC(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00030000 01005000 00100000 00000400 00080080 00000010 00000000 20000000 00200000 00020080 00200000 40033000 0600803a 01800001 80180000 00080008 10000000 00000000 02402000 00000201 00000000 30040e30 03000001 02100018 00000000 00000000 00000000 10000000 08000000 00040001 20024000 00802200 |