On Target ACE_HUMAN 0.32089552/CHEMBL86915
For the given ligand Gliclazide, we have found in our database that, being scored 0.32089552, the most similar ligand is CHEMBL86915. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL86915 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | OC(=O)CN1CCCCCCC(NC(CCc2ccccc2)C(=O)O)C1=O |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 00010000 01005200 00100102 04010600 00080080 00000000 00000000 20000000 00000800 000808c0 08302000 4001b000 0600800a 00202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e10 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20024000 00402600 |