On Target CXCR4_HUMAN 0.28985506/CHEMBL2170299
For the given ligand Miglitol, we have found in our database that, being scored 0.28985506, the most similar ligand is CHEMBL2170299. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL2170299 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | Cl.C[C@@H]1CCCCN1CCCNCc2ccc(CNCCCN3CCCC[C@@H]3C)cc2 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00000000 01000400 00100100 00010600 00000000 00000000 00000000 22001000 00000100 000009e0 00200000 50018000 80000802 00000000 00000400 00000000 00000000 02000000 00002000 00000201 00000000 18008010 00000000 00500010 00000000 c0000000 00000000 90000000 00000100 00060010 20040000 00022200 |