On Target CXCR4_HUMAN 0.31794873/CHEMBL3627858
For the given ligand Gliclazide, we have found in our database that, being scored 0.31794873, the most similar ligand is CHEMBL3627858. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL3627858 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | NCCCCN(C[C@H]1CN(CCN1)S(=O)(=O)c2ccccc2)[C@H]3CCCc4cccnc34 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 0000009a 01804400 01104102 15b00e10 000c1120 00100000 01022000 22003001 00700800 004909e0 0831a004 60838000 00000882 00202801 80a20400 02048104 00002200 06000006 00602408 00007603 c0120100 38038000 20804023 3a500038 02140000 c000000d 08004040 9000008c 08400506 20860012 20040002 20016660 |