On Target CNR2_HUMAN 0.44444445/CHEMBL2336561
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL2336561. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL2336561 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CCN(CC)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c3ccc(Cl)cc3)cc1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000c012 00800a00 01080100 81b10600 00080000 10000000 04000001 02001000 00000000 00001840 00302004 60008800 02000806 00008001 80200440 00000000 00042000 02100000 08400000 00006000 c0100000 08008100 20000000 08400008 02002000 c0000004 50000000 8000008c 00008500 20060000 00040000 00030360 |