On Target 5HT2C_HUMAN 0.4471154/CHEMBL583192
For the given ligand Linagliptin, we have found in our database that, being scored 0.4471154, the most similar ligand is CHEMBL583192. Check out the elaboration below.
| Linagliptin (Given Ligand) | CHEMBL583192 (Similar Ligand) |
|---|---|
| CC#CCn2c(N1CCC[C@@H](N)C1)nc5c2c(=O)n(Cc4nc(C)c3ccccc3n4)c(=O)n5C | C[C@@H]1CNCCN1C2=NC(=CC(=O)N2CCCOc3ccccc3)C |
|
|
|
|
|
|
| 0001022e 01801800 00382160 92050700 804c2160 0000c002 0000b200 00100801 86600110 b00008e0 0d21800c 50039800 04009002 00d0a000 003a00c0 120c000c 00a00000 0208c000 00600000 00a00201 c0000100 7e000068 618858c1 02700194 50140000 c0200008 62000000 100c1000 0900401c 00465a00 c0081002 80004aa0 | 04000006 00000808 20100148 04050600 01081064 02004100 02003000 00000400 06000100 a08008e0 0820200c 40018800 00809002 00d02000 01220081 001c200c 00200040 0280c000 00c00000 00a20200 80000000 3e002010 21800861 02300110 00000004 80000000 22000220 00040000 0900421d 00460800 40081000 800002e8 |