On Target HRH1_HUMAN 0.5897436/CHEMBL2171035
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.5897436, the most similar ligand is CHEMBL2171035. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL2171035 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | Clc1ccc(cc1)S(=O)(=O)NC(=O)N2CCC(CC2)N3CCC(CC3)Oc4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 04008010 01801608 21100108 02b10e00 00001000 12000000 9a000000 20003000 00000000 000029e0 00202000 f0018c00 02809006 00000043 81200003 00082008 02202000 00000400 00c00000 00026201 80002000 180d0500 01000080 08500018 00002001 00100000 90100000 1000040c 00000600 20060011 00180000 00032260 |