On Target HRH1_HUMAN 0.3611111/CHEMBL571174
For the given ligand Miglitol, we have found in our database that, being scored 0.3611111, the most similar ligand is CHEMBL571174. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL571174 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CC1CCC(CCCCN2CCC(CC2)C(O)(c3ccccc3)c4ccccc4)CC1 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00000000 01000000 00100102 00010600 00100000 00004000 00000000 21000000 00100900 000808c0 08300000 50018000 00000002 00200000 00000000 00080008 00000000 02000000 02402000 00000201 00000100 18000030 01000000 00500010 00000000 a0000000 00000000 50000000 00000080 00060002 40020000 00002e00 |