On Target HRH1_HUMAN 0.4857143/CHEMBL2171049
For the given ligand Gliclazide, we have found in our database that, being scored 0.4857143, the most similar ligand is CHEMBL2171049. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL2171049 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | Cc1ccc(cc1)S(=O)(=O)NC(=O)N2CCC(CC2)N3CCC(CC3)Oc4ccc(Cl)cc4 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 04008010 01801408 21100108 02b10e00 00001008 02000000 0a000000 20003000 00000000 000029e0 00202000 f0018c00 02809006 00000041 81200001 00082008 02202000 02000400 00c00000 00026201 80002000 180d0500 01000080 08500018 00002001 80000000 80100000 1000042c 00000600 20060011 00180000 00032260 |