On Target MK03_HUMAN 0.24666667/CHEMBL3798692
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.24666667, the most similar ligand is CHEMBL3798692. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL3798692 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CC(NC(=O)c1ccc2[nH]nc(c3cc(F)c(O)c(F)c3)c2c1)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000a000 0c808808 a0100100 42010600 01040000 00000012 06400000 02001000 02000100 00092848 08200000 f0008800 82018836 00401000 80000400 0004200c 00222800 02000004 04600000 10220200 80000000 0c068708 10800800 0060401c 00102000 c0000000 10024000 80000061 00004104 00068003 80040200 00024620 |