On Target MK03_HUMAN 0.26666668/CHEMBL3113587
For the given ligand Gliclazide, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL3113587. Check out the elaboration below.
| Gliclazide (Given Ligand) | CHEMBL3113587 (Similar Ligand) |
|---|---|
| Cc3ccc(S(=O)(=O)NC(=O)NN2CC1CCCC1C2)cc3 | CCCCCCCCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NCCc2ccccc2 |
|
|
|
|
|
|
| 0000001c 01801000 01100100 02b10e00 00000008 00000010 00000000 20001002 00000000 000068c0 00702008 e0018000 00018002 00200041 a0200080 00000000 02002000 02000000 04402000 00006201 80002000 18010410 40004000 08500018 40200000 80000000 00000000 1000002c 01000400 210e0002 40020000 0001a268 | 01010000 01403000 00100100 04010600 00000000 00014000 00000000 2000000c 00800380 000808c0 08200000 4001b000 0e00800a 00012001 00000000 021a0008 00020000 02000400 00002890 00000201 00000000 38240e30 00000003 83500018 00000000 80002002 00000000 10200020 0c000200 00060003 e0024000 00002600 |