On Target NMDZ1_HUMAN 0.18592964/CHEMBL401253
For the given ligand Rofecoxib, we have found in our database that, being scored 0.18592964, the most similar ligand is CHEMBL401253. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL401253 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CCc1c(Cl)cc2NC(=O)C(=O)Nc2c1N(CCO)S(=O)(=O)C |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 0001c022 0000c804 00001906 41310620 000c00c0 08000040 08008006 00401100 06040000 00080860 0c202004 40008800 82008c0c 00400001 809e0041 000e000c 0c068000 02000404 08200000 01004000 40140481 18848900 23800000 40600850 82006082 c0100200 180084c0 000210bc 04488000 00460002 00040000 204326e0 |