Created at: Last updated at: Current status:
|
Name | Amantadine |
2D and 3D depictions | |
SMILES | NC23CC1CC(CC(C1)C2)C3 |
Model downloads | |
Fingerprints |
Name | Alfentanil |
2D and 3D depictions | |
SMILES | CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 |
Model downloads | |
Fingerprints |
Name | Pimecrolimus |
2D and 3D depictions | |
SMILES | CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC |
Model downloads | |
Fingerprints |
Name | Levacetylmethadol |
2D and 3D depictions | |
SMILES | CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 |
Model downloads | |
Fingerprints |
Name | Rofecoxib |
2D and 3D depictions | |
SMILES | CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 |
Model downloads | |
Fingerprints |