On Target PERM_HUMAN 0.20714286/CHEMBL2347182
For the given ligand Rofecoxib, we have found in our database that, being scored 0.20714286, the most similar ligand is CHEMBL2347182. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL2347182 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | NC(=O)CCc1c[nH]c2c(F)cccc12 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00000002 00000a00 00100100 46810610 00041200 00000010 00002000 00000000 00400800 000808c0 08100004 40009000 0d008800 00401800 00020040 00040004 00000000 02002080 00200408 00100001 40000100 18008608 20800000 80400010 00043800 80000000 08000000 00000001 00000000 0007800a 00040a00 00000620 |