On Target PERM_HUMAN 0.37078652/CHEMBL3892909
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.37078652, the most similar ligand is CHEMBL3892909. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL3892909 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Oc1ccccc1CCCNCc2ccccc2 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 00000208 20100100 00010600 00000000 00000000 02000000 22001200 00000800 000808c0 08300000 40008040 00000802 00000000 00000400 00042008 00000000 02000000 00000000 00020201 00000100 18008000 00000000 00400010 00000000 c0000000 00000000 90000000 00000100 0006800a 20040000 00000600 |