On Target ACES_HUMAN 0.42990655/CHEMBL1773490
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.42990655, the most similar ligand is CHEMBL1773490. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL1773490 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CCN(CC)CCCCCCCOc1ccc(cc1)C(=O)c2ccc(CN(C)Cc3ccccc3)cc2 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 04000000 01000808 20100109 40010700 00081000 02000000 02040000 23001000 00000100 000808c0 08200000 40018800 80808802 00800000 11000401 00082008 00802000 02000000 00402000 00020201 00000000 18028210 01000000 00500014 00000000 e0000000 00120000 d0000000 00000380 00060002 80060000 00000600 |