On Target PDE5A_HUMAN 0.31/CHEMBL551948
For the given ligand Alfentanil, we have found in our database that, being scored 0.31, the most similar ligand is CHEMBL551948. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL551948 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCCCCN1C(=O)CN(C)c2ncc(cc12)c3ccc(F)c(F)c3 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00006002 01801800 401041a1 06010630 24841000 0c002038 00000000 20300000 06000000 60002ad0 00282004 5001a200 01008802 0030b000 00060801 80140004 00061000 0200400c 0c200000 00b00207 40100000 3e068600 30802801 0270001a 00040003 80180080 080006a0 100000c1 0840c018 02468801 00007000 00000280 |