On Target FABP5_HUMAN 0.22695035/CHEMBL212860
For the given ligand Rofecoxib, we have found in our database that, being scored 0.22695035, the most similar ligand is CHEMBL212860. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL212860 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | OC(=O)Cc1cccc(OCc2ccccc2Cl)c1OCc3ccccc3Cl |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 04008000 42000008 20000108 00210200 00001041 80004000 02000000 08008200 00000100 00080840 08000000 40009900 0380c006 20010080 41040001 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 01000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40002000 00020400 |