On Target FABP5_HUMAN 0.232/CHEMBL212860
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.232, the most similar ligand is CHEMBL212860. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL212860 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | OC(=O)Cc1cccc(OCc2ccccc2Cl)c1OCc3ccccc3Cl |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 04008000 42000008 20000108 00210200 00001041 80004000 02000000 08008200 00000100 00080840 08000000 40009900 0380c006 20010080 41040001 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 01000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40002000 00020400 |