On Target PAR1_HUMAN 0.4019608/CHEMBL3658406
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.4019608, the most similar ligand is CHEMBL3658406. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL3658406 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CCc1ccc(cc1)C2CC(CN(C2)C(=O)C3CCCC3)NC(=O)C(C)(C)C |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00010000 01003200 00100102 04010600 00000000 00000000 00000000 2000000c 00300980 000808c0 08300000 50039800 0400800a 00202000 00000000 00040000 00000000 02000000 00002000 00000201 00000100 38240610 00000001 83500018 00000000 80000000 00000000 10000000 0c000000 0106000b 00000000 00002600 |