On Target MK01_HUMAN 0.38674033/CHEMBL3398602
For the given ligand Alfentanil, we have found in our database that, being scored 0.38674033, the most similar ligand is CHEMBL3398602. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL3398602 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | COc1ncc(cn1)c2ccc(cc2)N3CCN(CC3)C(=O)CN4CC[C@H](C4)C(=O)Nc5ccc(O)c(Cl)c5 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 0002c002 00002c18 20100120 05010610 a0000000 00006118 0a000000 20004008 00200100 00000be0 00280004 4002b800 0e008026 0010a001 a0020240 801c000c 10060000 02000000 0c400010 40024201 60120000 380a0700 20802063 0240001a 00043001 80080800 00040200 100020c0 0801c200 00460011 40004000 04820280 |