On Target HYES_HUMAN 0.53271025/CHEMBL2070334
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.53271025, the most similar ligand is CHEMBL2070334. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL2070334 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CCOCCOCC(OC(=O)C1CCCC(C1)NC(=O)NC23CC4CC(CC(C4)C2)C3)c5ccccc5 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00030000 01001000 00100508 00010f00 00180050 00004000 00000004 00002040 00002100 000808c0 08200000 40019000 04009008 00810000 00040000 020a9008 08820000 02000000 06402040 00000001 00010120 18050e30 05000000 08500018 00010400 80002000 00080200 10000020 00000200 00060003 400a0000 02800e00 |