On Target TRPV3_HUMAN 0.108333334/CHEMBL3692292
For the given ligand Amantadine, we have found in our database that, being scored 0.108333334, the most similar ligand is CHEMBL3692292. Check out the elaboration below.
| Amantadine (Given Ligand) | CHEMBL3692292 (Similar Ligand) |
|---|---|
| NC23CC1CC(CC(C1)C2)C3 | OCC1(CCCCC1)NCc2nc(ccc2F)c3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000080 00000000 40010000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 10000010 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 0000209a 01000000 00104100 16010e00 008c00a1 00180022 00400400 22083041 00000100 100008d0 00218004 40018000 00000802 01801000 00020400 020c010d 12020200 02002022 06602000 10500201 40000000 18018010 33800000 20500010 00100000 c0000000 00000140 90001041 00004104 00260400 20160800 20004200 |